C21H33N3O2 — CID 51158606
4-N-(6-methylheptan-2-yl)-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 51158606) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 4-N-(6-methylheptan-2-yl)-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(6-methylheptan-2-yl)-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 51158606 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 4-N-(6-methylheptan-2-yl)-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | CC(C)CCCC(C)NC(=O)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N3O2/c1-16(2)8-7-9-17(3)22-20(25)18-12-14-24(15-13-18)21(26)23-19-10-5-4-6-11-19/h4-6,10-11,16-18H,7-9,12-15H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | NGPFNEZGBHULGE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |