C21H23F2N3O2 — CID 26753074
4-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 26753074) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 4-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 26753074 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-N-[(1R)-1-(2,4-difluorophenyl)ethyl]-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | C[C@@H](NC(=O)C1CCN(C(=O)Nc2ccccc2)CC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H23F2N3O2/c1-14(18-8-7-16(22)13-19(18)23)24-20(27)15-9-11-26(12-10-15)21(28)25-17-5-3-2-4-6-17/h2-8,13-15H,9-12H2,1H3,(H,24,27)(H,25,28)/t14-/m1/s1 |
| InChIKey | JQFNJHNNTOOWJW-CQSZACIVSA-N |
| XLogP | 4.09 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |