C19H18F3N3O2 — CID 113008926
1-N-phenyl-4-N-(2,3,4-trifluorophenyl)piperidine-1,4-dicarboxamide (PubChem CID 113008926) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 1-N-phenyl-4-N-(2,3,4-trifluorophenyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-phenyl-4-N-(2,3,4-trifluorophenyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 113008926 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 1-N-phenyl-4-N-(2,3,4-trifluorophenyl)piperidine-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C19H18F3N3O2/c20-14-6-7-15(17(22)16(14)21)24-18(26)12-8-10-25(11-9-12)19(27)23-13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,23,27)(H,24,26) |
| InChIKey | TWYUILXRESUHQP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|