C18H19ClN4O2 — CID 51180162
4-N-(5-chloro-2-pyridinyl)-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 51180162) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 4-N-(5-chloro-2-pyridinyl)-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(5-chloro-2-pyridinyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 51180162 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-N-(5-chloro-2-pyridinyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C18H19ClN4O2/c19-14-6-7-16(20-12-14)22-17(24)13-8-10-23(11-9-13)18(25)21-15-4-2-1-3-5-15/h1-7,12-13H,8-11H2,(H,21,25)(H,20,22,24) |
| InChIKey | VLBHPOQOJCZZSQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |