C14H21Cl3N4O2 — CID 119856586
1-(3-aminopropanoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride (PubChem CID 119856586) has the molecular formula C14H21Cl3N4O2 and a molecular weight of 383.71 g/mol. Its IUPAC name is 1-(3-aminopropanoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride.
| Compound Name | 1-(3-aminopropanoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119856586 |
| Molecular Formula | C14H21Cl3N4O2 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 1-(3-aminopropanoyl)-N-(5-chloro-2-pyridinyl)piperidine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NCCC(=O)N1CCC(C(=O)Nc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C14H19ClN4O2.2ClH/c15-11-1-2-12(17-9-11)18-14(21)10-4-7-19(8-5-10)13(20)3-6-16;;/h1-2,9-10H,3-8,16H2,(H,17,18,21);2*1H |
| InChIKey | DECJBTKAYNTVGM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |