C23H28ClN3O2 — CID 55923776
N-(5-chloro-2-pyridinyl)-1-[3-(4-propan-2-ylphenyl)propanoyl]piperidine-4-carboxamide (PubChem CID 55923776) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[3-(4-propan-2-ylphenyl)propanoyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[3-(4-propan-2-ylphenyl)propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55923776 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[3-(4-propan-2-ylphenyl)propanoyl]piperidine-4-carboxamide |
| SMILES | CC(C)c1ccc(CCC(=O)N2CCC(C(=O)Nc3ccc(Cl)cn3)CC2)cc1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-16(2)18-6-3-17(4-7-18)5-10-22(28)27-13-11-19(12-14-27)23(29)26-21-9-8-20(24)15-25-21/h3-4,6-9,15-16,19H,5,10-14H2,1-2H3,(H,25,26,29) |
| InChIKey | BUKBIFGOSRRETR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |