C18H27ClN4O2 — CID 119856461
1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 119856461) has the molecular formula C18H27ClN4O2 and a molecular weight of 366.89 g/mol. Its IUPAC name is 1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 119856461 |
| Molecular Formula | C18H27ClN4O2 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-(7-aminoheptanoyl)-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | NCCCCCCC(=O)N1CCCC(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C18H27ClN4O2/c19-15-8-9-16(21-12-15)22-18(25)14-6-5-11-23(13-14)17(24)7-3-1-2-4-10-20/h8-9,12,14H,1-7,10-11,13,20H2,(H,21,22,25) |
| InChIKey | BLZUCNLXPXETGD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|