C24H28ClN3O5 — CID 55924665
1-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55924665) has the molecular formula C24H28ClN3O5 and a molecular weight of 473.96 g/mol. Its IUPAC name is 1-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55924665 |
| Molecular Formula | C24H28ClN3O5 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 1-[4-(4-acetyl-2-methoxyphenoxy)butanoyl]-N-(5-chloro-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | COc1cc(C(C)=O)ccc1OCCCC(=O)N1CCCC(C(=O)Nc2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C24H28ClN3O5/c1-16(29)17-7-9-20(21(13-17)32-2)33-12-4-6-23(30)28-11-3-5-18(15-28)24(31)27-22-10-8-19(25)14-26-22/h7-10,13-14,18H,3-6,11-12,15H2,1-2H3,(H,26,27,31) |
| InChIKey | YZCTYVGZIANWIV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|