C22H27ClN4O4S — CID 55818676
N-(5-chloro-2-pyridinyl)-1-[4-(diethylsulfamoyl)benzoyl]piperidine-3-carboxamide (PubChem CID 55818676) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[4-(diethylsulfamoyl)benzoyl]piperidine-3-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[4-(diethylsulfamoyl)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55818676 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[4-(diethylsulfamoyl)benzoyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N2CCCC(C(=O)Nc3ccc(Cl)cn3)C2)cc1 |
| InChI | InChI=1S/C22H27ClN4O4S/c1-3-27(4-2)32(30,31)19-10-7-16(8-11-19)22(29)26-13-5-6-17(15-26)21(28)25-20-12-9-18(23)14-24-20/h7-12,14,17H,3-6,13,15H2,1-2H3,(H,24,25,28) |
| InChIKey | MEVPDUWCLYBNOW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |