C17H26N4O4S — CID 9074203
(3S)-3-N-[4-(diethylsulfamoyl)phenyl]piperidine-1,3-dicarboxamide (PubChem CID 9074203) has the molecular formula C17H26N4O4S and a molecular weight of 382.49 g/mol. Its IUPAC name is (3S)-3-N-[4-(diethylsulfamoyl)phenyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-[4-(diethylsulfamoyl)phenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 9074203 |
| Molecular Formula | C17H26N4O4S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (3S)-3-N-[4-(diethylsulfamoyl)phenyl]piperidine-1,3-dicarboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)[C@H]2CCCN(C(N)=O)C2)cc1 |
| InChI | InChI=1S/C17H26N4O4S/c1-3-21(4-2)26(24,25)15-9-7-14(8-10-15)19-16(22)13-6-5-11-20(12-13)17(18)23/h7-10,13H,3-6,11-12H2,1-2H3,(H2,18,23)(H,19,22)/t13-/m0/s1 |
| InChIKey | NPKUDHSFHVWVHL-ZDUSSCGKSA-N |
| XLogP | 1.45 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |