C21H31N3O4S — CID 55683159
1-(cyclopropanecarbonyl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide (PubChem CID 55683159) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is 1-(cyclopropanecarbonyl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide.
| Compound Name | 1-(cyclopropanecarbonyl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55683159 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-(cyclopropanecarbonyl)-N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C2CCCN(C(=O)C3CC3)C2)ccc1C |
| InChI | InChI=1S/C21H31N3O4S/c1-4-24(5-2)29(27,28)19-13-18(11-8-15(19)3)22-20(25)17-7-6-12-23(14-17)21(26)16-9-10-16/h8,11,13,16-17H,4-7,9-10,12,14H2,1-3H3,(H,22,25) |
| InChIKey | FXXKEGPNMXNILE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |