C17H28ClN3O3S — CID 119263634
N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119263634) has the molecular formula C17H28ClN3O3S and a molecular weight of 389.95 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119263634 |
| Molecular Formula | C17H28ClN3O3S |
| Molecular Weight | 389.95 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C2CCCNC2)ccc1C.Cl |
| InChI | InChI=1S/C17H27N3O3S.ClH/c1-4-20(5-2)24(22,23)16-11-15(9-8-13(16)3)19-17(21)14-7-6-10-18-12-14;/h8-9,11,14,18H,4-7,10,12H2,1-3H3,(H,19,21);1H |
| InChIKey | AAKFLLAVNFEGDX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.95 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |