C14H22ClN3O3S — CID 119270691
N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-3-carboxamide;hydrochloride (PubChem CID 119270691) has the molecular formula C14H22ClN3O3S and a molecular weight of 347.87 g/mol. Its IUPAC name is N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-3-carboxamide;hydrochloride.
| Compound Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119270691 |
| Molecular Formula | C14H22ClN3O3S |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | N-[4-methyl-3-(methylsulfamoyl)phenyl]piperidine-3-carboxamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)C2CCCNC2)ccc1C.Cl |
| InChI | InChI=1S/C14H21N3O3S.ClH/c1-10-5-6-12(8-13(10)21(19,20)15-2)17-14(18)11-4-3-7-16-9-11;/h5-6,8,11,15-16H,3-4,7,9H2,1-2H3,(H,17,18);1H |
| InChIKey | IMRQDAHAWJQBQS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |