C19H24ClN3O3S — CID 119679353
N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119679353) has the molecular formula C19H24ClN3O3S and a molecular weight of 409.94 g/mol. Its IUPAC name is N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119679353 |
| Molecular Formula | C19H24ClN3O3S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(NC(=O)C3CCNC3)ccc2C)c1.Cl |
| InChI | InChI=1S/C19H23N3O3S.ClH/c1-13-4-3-5-17(10-13)22-26(24,25)18-11-16(7-6-14(18)2)21-19(23)15-8-9-20-12-15;/h3-7,10-11,15,20,22H,8-9,12H2,1-2H3,(H,21,23);1H |
| InChIKey | RLBWFZCRKZSFLL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |