C22H28N2O5S2 — CID 55789622
3-cyclopentylsulfonyl-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]propanamide (PubChem CID 55789622) has the molecular formula C22H28N2O5S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is 3-cyclopentylsulfonyl-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]propanamide.
| Compound Name | 3-cyclopentylsulfonyl-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 55789622 |
| Molecular Formula | C22H28N2O5S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 3-cyclopentylsulfonyl-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]propanamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(NC(=O)CCS(=O)(=O)C3CCCC3)ccc2C)c1 |
| InChI | InChI=1S/C22H28N2O5S2/c1-16-6-5-7-19(14-16)24-31(28,29)21-15-18(11-10-17(21)2)23-22(25)12-13-30(26,27)20-8-3-4-9-20/h5-7,10-11,14-15,20,24H,3-4,8-9,12-13H2,1-2H3,(H,23,25) |
| InChIKey | KGCFQKQNATXSHK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |