C19H26ClN3O3S — CID 120558919
4-amino-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pentanamide;hydrochloride (PubChem CID 120558919) has the molecular formula C19H26ClN3O3S and a molecular weight of 411.96 g/mol. Its IUPAC name is 4-amino-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120558919 |
| Molecular Formula | C19H26ClN3O3S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-amino-N-[4-methyl-3-[(3-methylphenyl)sulfamoyl]phenyl]pentanamide;hydrochloride |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(NC(=O)CCC(C)N)ccc2C)c1.Cl |
| InChI | InChI=1S/C19H25N3O3S.ClH/c1-13-5-4-6-17(11-13)22-26(24,25)18-12-16(9-7-14(18)2)21-19(23)10-8-15(3)20;/h4-7,9,11-12,15,22H,8,10,20H2,1-3H3,(H,21,23);1H |
| InChIKey | RUONNBKBJIZXNJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |