C24H30ClN3O4S — CID 55605664
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 55605664) has the molecular formula C24H30ClN3O4S and a molecular weight of 492.04 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55605664 |
| Molecular Formula | C24H30ClN3O4S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C2CCCN(C(=O)Cc3ccccc3)C2)ccc1Cl |
| InChI | InChI=1S/C24H30ClN3O4S/c1-3-28(4-2)33(31,32)22-16-20(12-13-21(22)25)26-24(30)19-11-8-14-27(17-19)23(29)15-18-9-6-5-7-10-18/h5-7,9-10,12-13,16,19H,3-4,8,11,14-15,17H2,1-2H3,(H,26,30) |
| InChIKey | YKXHYMHFUOQRIN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |