C24H24N4O4 — CID 167986303
1-[3-[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid (PubChem CID 167986303) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-[3-[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 167986303 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[3-[[1-(2-phenylacetyl)piperidine-3-carbonyl]amino]phenyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(-c2cccc(NC(=O)C3CCCN(C(=O)Cc4ccccc4)C3)c2)n1 |
| InChI | InChI=1S/C24H24N4O4/c29-22(14-17-6-2-1-3-7-17)27-12-5-8-18(16-27)23(30)25-19-9-4-10-20(15-19)28-13-11-21(26-28)24(31)32/h1-4,6-7,9-11,13,15,18H,5,8,12,14,16H2,(H,25,30)(H,31,32) |
| InChIKey | DYZQJUVNYHKWNF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |