C24H27N5O2 — CID 96521978
(3S)-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide (PubChem CID 96521978) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (3S)-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 96521978 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (3S)-N-[3-[(1-methylpyrazol-4-yl)amino]phenyl]-1-(2-phenylacetyl)piperidine-3-carboxamide |
| SMILES | Cn1cc(Nc2cccc(NC(=O)[C@H]3CCCN(C(=O)Cc4ccccc4)C3)c2)cn1 |
| InChI | InChI=1S/C24H27N5O2/c1-28-17-22(15-25-28)26-20-10-5-11-21(14-20)27-24(31)19-9-6-12-29(16-19)23(30)13-18-7-3-2-4-8-18/h2-5,7-8,10-11,14-15,17,19,26H,6,9,12-13,16H2,1H3,(H,27,31)/t19-/m0/s1 |
| InChIKey | YMPXJGUKMVYYKT-IBGZPJMESA-N |
| XLogP | 3.58 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |