C21H21ClN6O2 — CID 45250339
1-[2-(3-chlorophenyl)acetyl]-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide (PubChem CID 45250339) has the molecular formula C21H21ClN6O2 and a molecular weight of 424.89 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)acetyl]-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(3-chlorophenyl)acetyl]-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45250339 |
| Molecular Formula | C21H21ClN6O2 |
| Molecular Weight | 424.89 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-[2-(3-chlorophenyl)acetyl]-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cnnn2)c1)C1CCCN(C(=O)Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C21H21ClN6O2/c22-17-6-1-4-15(10-17)11-20(29)27-9-3-5-16(13-27)21(30)24-18-7-2-8-19(12-18)28-14-23-25-26-28/h1-2,4,6-8,10,12,14,16H,3,5,9,11,13H2,(H,24,30) |
| InChIKey | CUHMPOFOYUEMNU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |