C21H23N7O2 — CID 55896049
N-(3-methyl-2-pyridinyl)-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-3-carboxamide (PubChem CID 55896049) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-3-carboxamide.
| Compound Name | N-(3-methyl-2-pyridinyl)-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55896049 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidine-3-carboxamide |
| SMILES | Cc1cccnc1NC(=O)C1CCCN(C(=O)Cc2ccc(-n3cnnn3)cc2)C1 |
| InChI | InChI=1S/C21H23N7O2/c1-15-4-2-10-22-20(15)24-21(30)17-5-3-11-27(13-17)19(29)12-16-6-8-18(9-7-16)28-14-23-25-26-28/h2,4,6-10,14,17H,3,5,11-13H2,1H3,(H,22,24,30) |
| InChIKey | WFKSWWZOWBMJOO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |