C25H27ClN4O2 — CID 55896427
1-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55896427) has the molecular formula C25H27ClN4O2 and a molecular weight of 450.97 g/mol. Its IUPAC name is 1-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55896427 |
| Molecular Formula | C25H27ClN4O2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cccnc1NC(=O)C1CCCN(C(=O)c2cc(-n3c(C)ccc3C)ccc2Cl)C1 |
| InChI | InChI=1S/C25H27ClN4O2/c1-16-6-4-12-27-23(16)28-24(31)19-7-5-13-29(15-19)25(32)21-14-20(10-11-22(21)26)30-17(2)8-9-18(30)3/h4,6,8-12,14,19H,5,7,13,15H2,1-3H3,(H,27,28,31) |
| InChIKey | BOAVAECEUBBURV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|