C19H18Cl2FN3O2 — CID 60531808
1-(2,4-dichloro-5-fluorobenzoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 60531808) has the molecular formula C19H18Cl2FN3O2 and a molecular weight of 410.28 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-fluorobenzoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-(2,4-dichloro-5-fluorobenzoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 60531808 |
| Molecular Formula | C19H18Cl2FN3O2 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 1-(2,4-dichloro-5-fluorobenzoyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cccnc1NC(=O)C1CCCN(C(=O)c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C19H18Cl2FN3O2/c1-11-4-2-6-23-17(11)24-18(26)12-5-3-7-25(10-12)19(27)13-8-16(22)15(21)9-14(13)20/h2,4,6,8-9,12H,3,5,7,10H2,1H3,(H,23,24,26) |
| InChIKey | PMURNIMVNILYDC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|