C19H17F4N3O2 — CID 71939394
N-(3-methyl-2-pyridinyl)-1-(2,3,4,5-tetrafluorobenzoyl)piperidine-3-carboxamide (PubChem CID 71939394) has the molecular formula C19H17F4N3O2 and a molecular weight of 395.36 g/mol. Its IUPAC name is N-(3-methyl-2-pyridinyl)-1-(2,3,4,5-tetrafluorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-(3-methyl-2-pyridinyl)-1-(2,3,4,5-tetrafluorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 71939394 |
| Molecular Formula | C19H17F4N3O2 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-(3-methyl-2-pyridinyl)-1-(2,3,4,5-tetrafluorobenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1cccnc1NC(=O)C1CCCN(C(=O)c2cc(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C19H17F4N3O2/c1-10-4-2-6-24-17(10)25-18(27)11-5-3-7-26(9-11)19(28)12-8-13(20)15(22)16(23)14(12)21/h2,4,6,8,11H,3,5,7,9H2,1H3,(H,24,25,27) |
| InChIKey | KCXAYOFIKXIMFC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|