C22H24N4O2 — CID 52514561
(3R)-1-(1-methylindole-3-carbonyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 52514561) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (3R)-1-(1-methylindole-3-carbonyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(1-methylindole-3-carbonyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 52514561 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (3R)-1-(1-methylindole-3-carbonyl)-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1cccnc1NC(=O)[C@@H]1CCCN(C(=O)c2cn(C)c3ccccc23)C1 |
| InChI | InChI=1S/C22H24N4O2/c1-15-7-5-11-23-20(15)24-21(27)16-8-6-12-26(13-16)22(28)18-14-25(2)19-10-4-3-9-17(18)19/h3-5,7,9-11,14,16H,6,8,12-13H2,1-2H3,(H,23,24,27)/t16-/m1/s1 |
| InChIKey | BSCPBBHIUZHGIH-MRXNPFEDSA-N |
| XLogP | 3.37 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |