C15H20N6O3S — CID 55679023
N-[1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidin-3-yl]methanesulfonamide (PubChem CID 55679023) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | N-[1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 55679023 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-[1-[2-[4-(tetrazol-1-yl)phenyl]acetyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCCN(C(=O)Cc2ccc(-n3cnnn3)cc2)C1 |
| InChI | InChI=1S/C15H20N6O3S/c1-25(23,24)17-13-3-2-8-20(10-13)15(22)9-12-4-6-14(7-5-12)21-11-16-18-19-21/h4-7,11,13,17H,2-3,8-10H2,1H3 |
| InChIKey | GPGMLYOJGZUOCT-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |