C21H21N7O — CID 91946745
1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone (PubChem CID 91946745) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 91946745 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(-n2cnnn2)cc1)N1CCCC(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C21H21N7O/c29-20(12-15-7-9-17(10-8-15)28-14-22-25-26-28)27-11-3-4-16(13-27)21-23-18-5-1-2-6-19(18)24-21/h1-2,5-10,14,16H,3-4,11-13H2,(H,23,24) |
| InChIKey | KQOAQDZUFZGXGK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |