C15H18N6O — CID 120656068
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone (PubChem CID 120656068) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 120656068 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(tetrazol-1-yl)phenyl]ethanone |
| SMILES | O=C(Cc1ccc(-n2cnnn2)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C15H18N6O/c22-15(20-8-12-6-16-7-13(12)9-20)5-11-1-3-14(4-2-11)21-10-17-18-19-21/h1-4,10,12-13,16H,5-9H2/t12-,13+ |
| InChIKey | CXDHMYGKRFCIBL-BETUJISGSA-N |
| XLogP | -0.12 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |