C13H20ClN3O3S — CID 119793520
N-[1-[2-(4-aminophenyl)acetyl]pyrrolidin-3-yl]methanesulfonamide;hydrochloride (PubChem CID 119793520) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is N-[1-[2-(4-aminophenyl)acetyl]pyrrolidin-3-yl]methanesulfonamide;hydrochloride.
| Compound Name | N-[1-[2-(4-aminophenyl)acetyl]pyrrolidin-3-yl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119793520 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-[1-[2-(4-aminophenyl)acetyl]pyrrolidin-3-yl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)NC1CCN(C(=O)Cc2ccc(N)cc2)C1.Cl |
| InChI | InChI=1S/C13H19N3O3S.ClH/c1-20(18,19)15-12-6-7-16(9-12)13(17)8-10-2-4-11(14)5-3-10;/h2-5,12,15H,6-9,14H2,1H3;1H |
| InChIKey | ZGBNVYSNEYSUKA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|