C20H22N6O3S — CID 1456951
(3S)-N-(2-methylphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 1456951) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is (3S)-N-(2-methylphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-methylphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 1456951 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (3S)-N-(2-methylphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | Cc1ccccc1NC(=O)[C@H]1CCCN(S(=O)(=O)c2ccc(-n3cnnn3)cc2)C1 |
| InChI | InChI=1S/C20H22N6O3S/c1-15-5-2-3-7-19(15)22-20(27)16-6-4-12-25(13-16)30(28,29)18-10-8-17(9-11-18)26-14-21-23-24-26/h2-3,5,7-11,14,16H,4,6,12-13H2,1H3,(H,22,27)/t16-/m0/s1 |
| InChIKey | JHXNCLCAXVGJMN-INIZCTEOSA-N |
| XLogP | 2.01 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |