C21H24N6O4S — CID 1458111
(3R)-N-(4-ethoxyphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 1458111) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is (3R)-N-(4-ethoxyphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | (3R)-N-(4-ethoxyphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 1458111 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (3R)-N-(4-ethoxyphenyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc(-n4cnnn4)cc3)C2)cc1 |
| InChI | InChI=1S/C21H24N6O4S/c1-2-31-19-9-5-17(6-10-19)23-21(28)16-4-3-13-26(14-16)32(29,30)20-11-7-18(8-12-20)27-15-22-24-25-27/h5-12,15-16H,2-4,13-14H2,1H3,(H,23,28)/t16-/m1/s1 |
| InChIKey | IOGRUSHAHXNMKR-MRXNPFEDSA-N |
| XLogP | 2.10 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |