C16H22N6O4S — CID 3214836
N-(2-methoxyethyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide (PubChem CID 3214836) has the molecular formula C16H22N6O4S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 3214836 |
| Molecular Formula | C16H22N6O4S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(2-methoxyethyl)-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine-3-carboxamide |
| SMILES | COCCNC(=O)C1CCCN(S(=O)(=O)c2ccc(-n3cnnn3)cc2)C1 |
| InChI | InChI=1S/C16H22N6O4S/c1-26-10-8-17-16(23)13-3-2-9-21(11-13)27(24,25)15-6-4-14(5-7-15)22-12-18-19-20-22/h4-7,12-13H,2-3,8-11H2,1H3,(H,17,23) |
| InChIKey | IYSHBVCKGXVCCO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|