C18H18N6O2S — CID 42214946
(3S)-N-[3-(tetrazol-1-yl)phenyl]-1-(thiophene-3-carbonyl)piperidine-3-carboxamide (PubChem CID 42214946) has the molecular formula C18H18N6O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is (3S)-N-[3-(tetrazol-1-yl)phenyl]-1-(thiophene-3-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(tetrazol-1-yl)phenyl]-1-(thiophene-3-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42214946 |
| Molecular Formula | C18H18N6O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | (3S)-N-[3-(tetrazol-1-yl)phenyl]-1-(thiophene-3-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cnnn2)c1)[C@H]1CCCN(C(=O)c2ccsc2)C1 |
| InChI | InChI=1S/C18H18N6O2S/c25-17(20-15-4-1-5-16(9-15)24-12-19-21-22-24)13-3-2-7-23(10-13)18(26)14-6-8-27-11-14/h1,4-6,8-9,11-13H,2-3,7,10H2,(H,20,25)/t13-/m0/s1 |
| InChIKey | IEJGNRZGIWPDIO-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |