C15H19N7O2 — CID 125166963
(3S)-3-N-ethyl-1-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 125166963) has the molecular formula C15H19N7O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is (3S)-3-N-ethyl-1-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-ethyl-1-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 125166963 |
| Molecular Formula | C15H19N7O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (3S)-3-N-ethyl-1-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | CCNC(=O)[C@H]1CCN(C(=O)Nc2cccc(-n3cnnn3)c2)C1 |
| InChI | InChI=1S/C15H19N7O2/c1-2-16-14(23)11-6-7-21(9-11)15(24)18-12-4-3-5-13(8-12)22-10-17-19-20-22/h3-5,8,10-11H,2,6-7,9H2,1H3,(H,16,23)(H,18,24)/t11-/m0/s1 |
| InChIKey | KSFMCTKVCQTVLN-NSHDSACASA-N |
| XLogP | 0.65 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |