C22H22N6O2 — CID 45214258
1-(1-benzofuran-2-ylmethyl)-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide (PubChem CID 45214258) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-(1-benzofuran-2-ylmethyl)-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(1-benzofuran-2-ylmethyl)-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45214258 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-(1-benzofuran-2-ylmethyl)-N-[3-(tetrazol-1-yl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(-n2cnnn2)c1)C1CCCN(Cc2cc3ccccc3o2)C1 |
| InChI | InChI=1S/C22H22N6O2/c29-22(24-18-7-3-8-19(12-18)28-15-23-25-26-28)17-6-4-10-27(13-17)14-20-11-16-5-1-2-9-21(16)30-20/h1-3,5,7-9,11-12,15,17H,4,6,10,13-14H2,(H,24,29) |
| InChIKey | DFRMRSDFQBUSLL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |