C20H22N6O — CID 26409028
(2R)-1-[(4-methylphenyl)methyl]-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 26409028) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is (2R)-1-[(4-methylphenyl)methyl]-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[(4-methylphenyl)methyl]-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 26409028 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2R)-1-[(4-methylphenyl)methyl]-N-[3-(tetrazol-1-yl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(CN2CCC[C@@H]2C(=O)Nc2cccc(-n3cnnn3)c2)cc1 |
| InChI | InChI=1S/C20H22N6O/c1-15-7-9-16(10-8-15)13-25-11-3-6-19(25)20(27)22-17-4-2-5-18(12-17)26-14-21-23-24-26/h2,4-5,7-10,12,14,19H,3,6,11,13H2,1H3,(H,22,27)/t19-/m1/s1 |
| InChIKey | AGZBWOGDGRZRBS-LJQANCHMSA-N |
| XLogP | 2.57 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |