C22H24N6O3 — CID 25448202
methyl 4-[[(2R)-2-[[4-(tetrazol-1-yl)phenyl]carbamoyl]piperidin-1-yl]methyl]benzoate (PubChem CID 25448202) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-[[4-(tetrazol-1-yl)phenyl]carbamoyl]piperidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(2R)-2-[[4-(tetrazol-1-yl)phenyl]carbamoyl]piperidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 25448202 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | methyl 4-[[(2R)-2-[[4-(tetrazol-1-yl)phenyl]carbamoyl]piperidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2CCCC[C@@H]2C(=O)Nc2ccc(-n3cnnn3)cc2)cc1 |
| InChI | InChI=1S/C22H24N6O3/c1-31-22(30)17-7-5-16(6-8-17)14-27-13-3-2-4-20(27)21(29)24-18-9-11-19(12-10-18)28-15-23-25-26-28/h5-12,15,20H,2-4,13-14H2,1H3,(H,24,29)/t20-/m1/s1 |
| InChIKey | HSLOOITWSHQKKL-HXUWFJFHSA-N |
| XLogP | 2.44 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |