C21H26N4O4 — CID 120629660
1-[3-[[(1-butanoylpiperidine-3-carbonyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid (PubChem CID 120629660) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-[3-[[(1-butanoylpiperidine-3-carbonyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[[(1-butanoylpiperidine-3-carbonyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 120629660 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1-[3-[[(1-butanoylpiperidine-3-carbonyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid |
| SMILES | CCCC(=O)N1CCCC(C(=O)NCc2cccc(-n3ccc(C(=O)O)n3)c2)C1 |
| InChI | InChI=1S/C21H26N4O4/c1-2-5-19(26)24-10-4-7-16(14-24)20(27)22-13-15-6-3-8-17(12-15)25-11-9-18(23-25)21(28)29/h3,6,8-9,11-12,16H,2,4-5,7,10,13-14H2,1H3,(H,22,27)(H,28,29) |
| InChIKey | JCGGZQLVKJESDK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |