C18H21N3O4 — CID 120629445
1-[3-[[(2-cyclopentyloxyacetyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid (PubChem CID 120629445) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-[3-[[(2-cyclopentyloxyacetyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[[(2-cyclopentyloxyacetyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 120629445 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[3-[[(2-cyclopentyloxyacetyl)amino]methyl]phenyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(COC1CCCC1)NCc1cccc(-n2ccc(C(=O)O)n2)c1 |
| InChI | InChI=1S/C18H21N3O4/c22-17(12-25-15-6-1-2-7-15)19-11-13-4-3-5-14(10-13)21-9-8-16(20-21)18(23)24/h3-5,8-10,15H,1-2,6-7,11-12H2,(H,19,22)(H,23,24) |
| InChIKey | JYRNGZASVHCPSP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |