C18H23N3O3S — CID 120629957
1-[3-[(3-butylsulfanylpropanoylamino)methyl]phenyl]pyrazole-3-carboxylic acid (PubChem CID 120629957) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 1-[3-[(3-butylsulfanylpropanoylamino)methyl]phenyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[(3-butylsulfanylpropanoylamino)methyl]phenyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 120629957 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-[3-[(3-butylsulfanylpropanoylamino)methyl]phenyl]pyrazole-3-carboxylic acid |
| SMILES | CCCCSCCC(=O)NCc1cccc(-n2ccc(C(=O)O)n2)c1 |
| InChI | InChI=1S/C18H23N3O3S/c1-2-3-10-25-11-8-17(22)19-13-14-5-4-6-15(12-14)21-9-7-16(20-21)18(23)24/h4-7,9,12H,2-3,8,10-11,13H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | KXLUZOKMABGAAA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|