C20H26ClN5O3S — CID 55577216
N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide (PubChem CID 55577216) has the molecular formula C20H26ClN5O3S and a molecular weight of 451.98 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55577216 |
| Molecular Formula | C20H26ClN5O3S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]-1-pyrimidin-2-ylpiperidine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C2CCCN(c3ncccn3)C2)ccc1Cl |
| InChI | InChI=1S/C20H26ClN5O3S/c1-3-26(4-2)30(28,29)18-13-16(8-9-17(18)21)24-19(27)15-7-5-12-25(14-15)20-22-10-6-11-23-20/h6,8-11,13,15H,3-5,7,12,14H2,1-2H3,(H,24,27) |
| InChIKey | KGEAIRWPHWLCGI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |