C17H23ClN2O3S — CID 51154870
N-[4-chloro-3-(diethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide (PubChem CID 51154870) has the molecular formula C17H23ClN2O3S and a molecular weight of 370.90 g/mol. Its IUPAC name is N-[4-chloro-3-(diethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 51154870 |
| Molecular Formula | C17H23ClN2O3S |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[4-chloro-3-(diethylsulfamoyl)phenyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)C2CC=CCC2)ccc1Cl |
| InChI | InChI=1S/C17H23ClN2O3S/c1-3-20(4-2)24(22,23)16-12-14(10-11-15(16)18)19-17(21)13-8-6-5-7-9-13/h5-6,10-13H,3-4,7-9H2,1-2H3,(H,19,21) |
| InChIKey | AKXYZQSOHCVEKE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|