C16H25ClN2O3S2 — CID 78780498
2-tert-butylsulfanyl-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 78780498) has the molecular formula C16H25ClN2O3S2 and a molecular weight of 392.97 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-tert-butylsulfanyl-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78780498 |
| Molecular Formula | C16H25ClN2O3S2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-tert-butylsulfanyl-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)CSC(C)(C)C)ccc1Cl |
| InChI | InChI=1S/C16H25ClN2O3S2/c1-6-19(7-2)24(21,22)14-10-12(8-9-13(14)17)18-15(20)11-23-16(3,4)5/h8-10H,6-7,11H2,1-5H3,(H,18,20) |
| InChIKey | FTQGFFPFAWQDKD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |