C18H23Cl2N3O3S — CID 119679885
2-(4-aminophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide;hydrochloride (PubChem CID 119679885) has the molecular formula C18H23Cl2N3O3S and a molecular weight of 432.37 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119679885 |
| Molecular Formula | C18H23Cl2N3O3S |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-(4-aminophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)Cc2ccc(N)cc2)ccc1Cl.Cl |
| InChI | InChI=1S/C18H22ClN3O3S.ClH/c1-3-22(4-2)26(24,25)17-12-15(9-10-16(17)19)21-18(23)11-13-5-7-14(20)8-6-13;/h5-10,12H,3-4,11,20H2,1-2H3,(H,21,23);1H |
| InChIKey | DWKVBHUNMYQSJQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|