C19H25N3O5S2 — CID 56511573
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-sulfamoylphenyl)acetamide (PubChem CID 56511573) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-sulfamoylphenyl)acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 56511573 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-sulfamoylphenyl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)Cc2ccc(S(N)(=O)=O)cc2)ccc1C |
| InChI | InChI=1S/C19H25N3O5S2/c1-4-22(5-2)29(26,27)18-13-16(9-6-14(18)3)21-19(23)12-15-7-10-17(11-8-15)28(20,24)25/h6-11,13H,4-5,12H2,1-3H3,(H,21,23)(H2,20,24,25) |
| InChIKey | ODPHZPGLVSFWKL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |