C18H20BrClN2O3S — CID 51618352
2-(4-bromophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide (PubChem CID 51618352) has the molecular formula C18H20BrClN2O3S and a molecular weight of 459.79 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51618352 |
| Molecular Formula | C18H20BrClN2O3S |
| Molecular Weight | 459.79 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2-(4-bromophenyl)-N-[4-chloro-3-(diethylsulfamoyl)phenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)Cc2ccc(Br)cc2)ccc1Cl |
| InChI | InChI=1S/C18H20BrClN2O3S/c1-3-22(4-2)26(24,25)17-12-15(9-10-16(17)20)21-18(23)11-13-5-7-14(19)8-6-13/h5-10,12H,3-4,11H2,1-2H3,(H,21,23) |
| InChIKey | UUOCXDBMILAGFA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |