C18H19BrClNO4S — CID 3281327
(4-bromophenyl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 3281327) has the molecular formula C18H19BrClNO4S and a molecular weight of 460.78 g/mol. Its IUPAC name is (4-bromophenyl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | (4-bromophenyl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3281327 |
| Molecular Formula | C18H19BrClNO4S |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | (4-bromophenyl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCc2ccc(Br)cc2)ccc1Cl |
| InChI | InChI=1S/C18H19BrClNO4S/c1-3-21(4-2)26(23,24)17-11-14(7-10-16(17)20)18(22)25-12-13-5-8-15(19)9-6-13/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | DNYPLEODBOJHKT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |