C20H21ClN4O4S — CID 27911696
(4-aminoquinazolin-2-yl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 27911696) has the molecular formula C20H21ClN4O4S and a molecular weight of 448.93 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 27911696 |
| Molecular Formula | C20H21ClN4O4S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCc2nc(N)c3ccccc3n2)ccc1Cl |
| InChI | InChI=1S/C20H21ClN4O4S/c1-3-25(4-2)30(27,28)17-11-13(9-10-15(17)21)20(26)29-12-18-23-16-8-6-5-7-14(16)19(22)24-18/h5-11H,3-4,12H2,1-2H3,(H2,22,23,24) |
| InChIKey | GFTOUGWLXYXVDJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |