C23H27ClN2O5S — CID 55524939
[2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 55524939) has the molecular formula C23H27ClN2O5S and a molecular weight of 479.00 g/mol. Its IUPAC name is [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55524939 |
| Molecular Formula | C23H27ClN2O5S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)NC(c2ccccc2)C2CC2)ccc1Cl |
| InChI | InChI=1S/C23H27ClN2O5S/c1-3-26(4-2)32(29,30)20-14-18(12-13-19(20)24)23(28)31-15-21(27)25-22(17-10-11-17)16-8-6-5-7-9-16/h5-9,12-14,17,22H,3-4,10-11,15H2,1-2H3,(H,25,27) |
| InChIKey | MFXJCEIGAXRIRI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |