C21H24Cl2N2O5S — CID 55313748
[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 55313748) has the molecular formula C21H24Cl2N2O5S and a molecular weight of 487.41 g/mol. Its IUPAC name is [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55313748 |
| Molecular Formula | C21H24Cl2N2O5S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)NC(C)c2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C21H24Cl2N2O5S/c1-4-25(5-2)31(28,29)19-12-16(8-11-18(19)23)21(27)30-13-20(26)24-14(3)15-6-9-17(22)10-7-15/h6-12,14H,4-5,13H2,1-3H3,(H,24,26) |
| InChIKey | VWQZRJIVLLWFKV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |